About 2-fluoro-1-N,2-dimethylcyclohexa-3,5-diene-1,3-diamine
2-fluoro-1-N,2-dimethylcyclohexa-3,5-diene-1,3-diamine (PubChem CID 154997179) has the molecular formula C8H13FN2
and a molecular weight of 156.20 g/mol. Its IUPAC name is 2-fluoro-1-N,2-dimethylcyclohexa-3,5-diene-1,3-diamine.
Analyze 2-fluoro-1-N,2-dimethylcyclohexa-3,5-diene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-1-N,2-dimethylcyclohexa-3,5-diene-1,3-diamine?
The IUPAC name of 2-fluoro-1-N,2-dimethylcyclohexa-3,5-diene-1,3-diamine (CID 154997179) is 2-fluoro-1-N,2-dimethylcyclohexa-3,5-diene-1,3-diamine.
What is the SMILES notation for 2-fluoro-1-N,2-dimethylcyclohexa-3,5-diene-1,3-diamine?
The canonical SMILES for 2-fluoro-1-N,2-dimethylcyclohexa-3,5-diene-1,3-diamine is CNC1C=CC=C(N)C1(C)F.
What is the InChIKey of 2-fluoro-1-N,2-dimethylcyclohexa-3,5-diene-1,3-diamine?
The InChIKey is ZICMUFXUYMHLGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13FN2/c1-8(9)6(10)4-3-5-7(8)11-2/h3-5,7,11H,10H2,1-2H3.
What are the key properties of 2-fluoro-1-N,2-dimethylcyclohexa-3,5-diene-1,3-diamine?
2-fluoro-1-N,2-dimethylcyclohexa-3,5-diene-1,3-diamine has a molecular weight of 156.20 g/mol, XLogP of 0.71, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-1-N,2-dimethylcyclohexa-3,5-diene-1,3-diamine is sourced from PubChem (CID 154997179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).