About 5-fluoro-4-N-(oxolan-3-yl)-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine
5-fluoro-4-N-(oxolan-3-yl)-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine (PubChem CID 154997786) has the molecular formula C16H16FN5O
and a molecular weight of 313.34 g/mol. Its IUPAC name is 5-fluoro-4-N-(oxolan-3-yl)-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine.
Molecular Properties
| Compound Name | 5-fluoro-4-N-(oxolan-3-yl)-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine |
| PubChem CID | 154997786 |
| Molecular Formula | C16H16FN5O |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 5-fluoro-4-N-(oxolan-3-yl)-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine |
| SMILES | Nc1cc(NC2CCOC2)c2c(F)cc(-c3ccn[nH]3)cc2n1 |
| InChI | InChI=1S/C16H16FN5O/c17-11-5-9(12-1-3-19-22-12)6-13-16(11)14(7-15(18)21-13)20-10-2-4-23-8-10/h1,3,5-7,10H,2,4,8H2,(H,19,22)(H3,18,20,21) |
| InChIKey | MNBYHPPWLINJLU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-fluoro-4-N-(oxolan-3-yl)-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-4-N-(oxolan-3-yl)-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine?
The IUPAC name of 5-fluoro-4-N-(oxolan-3-yl)-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine (CID 154997786) is 5-fluoro-4-N-(oxolan-3-yl)-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine.
What is the SMILES notation for 5-fluoro-4-N-(oxolan-3-yl)-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine?
The canonical SMILES for 5-fluoro-4-N-(oxolan-3-yl)-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine is Nc1cc(NC2CCOC2)c2c(F)cc(-c3ccn[nH]3)cc2n1.
What is the InChIKey of 5-fluoro-4-N-(oxolan-3-yl)-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine?
The InChIKey is MNBYHPPWLINJLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16FN5O/c17-11-5-9(12-1-3-19-22-12)6-13-16(11)14(7-15(18)21-13)20-10-2-4-23-8-10/h1,3,5-7,10H,2,4,8H2,(H,19,22)(H3,18,20,21).
What are the key properties of 5-fluoro-4-N-(oxolan-3-yl)-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine?
5-fluoro-4-N-(oxolan-3-yl)-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine has a molecular weight of 313.34 g/mol, XLogP of 2.55, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-4-N-(oxolan-3-yl)-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine is sourced from PubChem (CID 154997786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).