About 2-methylprop-2-enyl phosphono hydrogen phosphate
2-methylprop-2-enyl phosphono hydrogen phosphate (PubChem CID 154998361) has the molecular formula C4H10O7P2
and a molecular weight of 232.06 g/mol. Its IUPAC name is 2-methylprop-2-enyl phosphono hydrogen phosphate.
Molecular Properties
| Compound Name | 2-methylprop-2-enyl phosphono hydrogen phosphate |
| PubChem CID | 154998361 |
| Molecular Formula | C4H10O7P2 |
| Molecular Weight | 232.06 g/mol |
| Exact Mass | 231.99 |
| IUPAC Name | 2-methylprop-2-enyl phosphono hydrogen phosphate |
| SMILES | C=C(C)COP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C4H10O7P2/c1-4(2)3-10-13(8,9)11-12(5,6)7/h1,3H2,2H3,(H,8,9)(H2,5,6,7) |
| InChIKey | XPCAVWFFXXHADF-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.06 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enyl phosphono hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enyl phosphono hydrogen phosphate?
The IUPAC name of 2-methylprop-2-enyl phosphono hydrogen phosphate (CID 154998361) is 2-methylprop-2-enyl phosphono hydrogen phosphate.
What is the SMILES notation for 2-methylprop-2-enyl phosphono hydrogen phosphate?
The canonical SMILES for 2-methylprop-2-enyl phosphono hydrogen phosphate is C=C(C)COP(=O)(O)OP(=O)(O)O.
What is the InChIKey of 2-methylprop-2-enyl phosphono hydrogen phosphate?
The InChIKey is XPCAVWFFXXHADF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O7P2/c1-4(2)3-10-13(8,9)11-12(5,6)7/h1,3H2,2H3,(H,8,9)(H2,5,6,7).
What are the key properties of 2-methylprop-2-enyl phosphono hydrogen phosphate?
2-methylprop-2-enyl phosphono hydrogen phosphate has a molecular weight of 232.06 g/mol, XLogP of 0.79, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enyl phosphono hydrogen phosphate is sourced from PubChem (CID 154998361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).