C22H22FN5O — CID 154998794
3-[4-(3-fluorophenyl)-1H-benzimidazol-2-yl]-N-methyl-1-(oxan-2-yl)pyrazol-4-amine (PubChem CID 154998794) has the molecular formula C22H22FN5O and a molecular weight of 391.45 g/mol. Its IUPAC name is 3-[4-(3-fluorophenyl)-1H-benzimidazol-2-yl]-N-methyl-1-(oxan-2-yl)pyrazol-4-amine.
| Compound Name | 3-[4-(3-fluorophenyl)-1H-benzimidazol-2-yl]-N-methyl-1-(oxan-2-yl)pyrazol-4-amine |
|---|---|
| PubChem CID | 154998794 |
| Molecular Formula | C22H22FN5O |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 3-[4-(3-fluorophenyl)-1H-benzimidazol-2-yl]-N-methyl-1-(oxan-2-yl)pyrazol-4-amine |
| SMILES | CNc1cn(C2CCCCO2)nc1-c1nc2c(-c3cccc(F)c3)cccc2[nH]1 |
| InChI | InChI=1S/C22H22FN5O/c1-24-18-13-28(19-10-2-3-11-29-19)27-21(18)22-25-17-9-5-8-16(20(17)26-22)14-6-4-7-15(23)12-14/h4-9,12-13,19,24H,2-3,10-11H2,1H3,(H,25,26) |
| InChIKey | LGKLVQNHZKGCQW-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |