About (1Z,3Z)-4-fluoro-1-(methylideneamino)penta-1,3-dien-3-amine
(1Z,3Z)-4-fluoro-1-(methylideneamino)penta-1,3-dien-3-amine (PubChem CID 154999508) has the molecular formula C6H9FN2
and a molecular weight of 128.15 g/mol. Its IUPAC name is (1Z,3Z)-4-fluoro-1-(methylideneamino)penta-1,3-dien-3-amine.
Molecular Properties
| Compound Name | (1Z,3Z)-4-fluoro-1-(methylideneamino)penta-1,3-dien-3-amine |
| PubChem CID | 154999508 |
| Molecular Formula | C6H9FN2 |
| Molecular Weight | 128.15 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | (1Z,3Z)-4-fluoro-1-(methylideneamino)penta-1,3-dien-3-amine |
| SMILES | C=N/C=C\C(N)=C(/C)F |
| InChI | InChI=1S/C6H9FN2/c1-5(7)6(8)3-4-9-2/h3-4H,2,8H2,1H3/b4-3-,6-5- |
| InChIKey | LRCFTCDOVDVCPH-OUPQRBNQSA-N |
| XLogP | 1.36 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.15 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1Z,3Z)-4-fluoro-1-(methylideneamino)penta-1,3-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z,3Z)-4-fluoro-1-(methylideneamino)penta-1,3-dien-3-amine?
The IUPAC name of (1Z,3Z)-4-fluoro-1-(methylideneamino)penta-1,3-dien-3-amine (CID 154999508) is (1Z,3Z)-4-fluoro-1-(methylideneamino)penta-1,3-dien-3-amine.
What is the SMILES notation for (1Z,3Z)-4-fluoro-1-(methylideneamino)penta-1,3-dien-3-amine?
The canonical SMILES for (1Z,3Z)-4-fluoro-1-(methylideneamino)penta-1,3-dien-3-amine is C=N/C=C\C(N)=C(/C)F.
What is the InChIKey of (1Z,3Z)-4-fluoro-1-(methylideneamino)penta-1,3-dien-3-amine?
The InChIKey is LRCFTCDOVDVCPH-OUPQRBNQSA-N. The full InChI is InChI=1S/C6H9FN2/c1-5(7)6(8)3-4-9-2/h3-4H,2,8H2,1H3/b4-3-,6-5-.
What are the key properties of (1Z,3Z)-4-fluoro-1-(methylideneamino)penta-1,3-dien-3-amine?
(1Z,3Z)-4-fluoro-1-(methylideneamino)penta-1,3-dien-3-amine has a molecular weight of 128.15 g/mol, XLogP of 1.36, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z,3Z)-4-fluoro-1-(methylideneamino)penta-1,3-dien-3-amine is sourced from PubChem (CID 154999508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).