C17H14IN3O4S2 — CID 154999586
(3R)-4-(1,3-benzodioxol-4-yl)-3-iodo-7,11-dimethyl-6,10-dioxo-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-3-carbonitrile (PubChem CID 154999586) has the molecular formula C17H14IN3O4S2 and a molecular weight of 515.35 g/mol. Its IUPAC name is (3R)-4-(1,3-benzodioxol-4-yl)-3-iodo-7,11-dimethyl-6,10-dioxo-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-3-carbonitrile.
| Compound Name | (3R)-4-(1,3-benzodioxol-4-yl)-3-iodo-7,11-dimethyl-6,10-dioxo-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-3-carbonitrile |
|---|---|
| PubChem CID | 154999586 |
| Molecular Formula | C17H14IN3O4S2 |
| Molecular Weight | 515.35 g/mol |
| Exact Mass | 514.95 |
| IUPAC Name | (3R)-4-(1,3-benzodioxol-4-yl)-3-iodo-7,11-dimethyl-6,10-dioxo-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-3-carbonitrile |
| SMILES | CN1C(=O)C23C[C@](I)(C#N)C(c4cccc5c4OCO5)N2C(=O)C1(C)SS3 |
| InChI | InChI=1S/C17H14IN3O4S2/c1-15-13(22)21-12(9-4-3-5-10-11(9)25-8-24-10)16(18,7-19)6-17(21,27-26-15)14(23)20(15)2/h3-5,12H,6,8H2,1-2H3/t12?,15?,16-,17?/m0/s1 |
| InChIKey | VXQJWOHDBJOJGC-DZYMEOLHSA-N |
| XLogP | 2.67 |
| TPSA | 82.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|