C17H31FN2 — CID 154999657
N-[(2E,4E)-5-ethyl-6,6-dimethylhepta-2,4-dien-3-yl]-3-fluoro-1-methylpiperidin-4-amine (PubChem CID 154999657) has the molecular formula C17H31FN2 and a molecular weight of 282.45 g/mol. Its IUPAC name is N-[(2E,4E)-5-ethyl-6,6-dimethylhepta-2,4-dien-3-yl]-3-fluoro-1-methylpiperidin-4-amine.
| Compound Name | N-[(2E,4E)-5-ethyl-6,6-dimethylhepta-2,4-dien-3-yl]-3-fluoro-1-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 154999657 |
| Molecular Formula | C17H31FN2 |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.25 |
| IUPAC Name | N-[(2E,4E)-5-ethyl-6,6-dimethylhepta-2,4-dien-3-yl]-3-fluoro-1-methylpiperidin-4-amine |
| SMILES | C/C=C(\C=C(/CC)C(C)(C)C)NC1CCN(C)CC1F |
| InChI | InChI=1S/C17H31FN2/c1-7-13(17(3,4)5)11-14(8-2)19-16-9-10-20(6)12-15(16)18/h8,11,15-16,19H,7,9-10,12H2,1-6H3/b13-11+,14-8+ |
| InChIKey | HXQYAEKQIQJLMA-BCMCLHILSA-N |
| XLogP | 3.90 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|