C20H33N — CID 154999871
3-(4,5-dimethylheptan-2-yl)-3,4-dimethyl-5-penta-1,4-dien-2-ylpyrrole (PubChem CID 154999871) has the molecular formula C20H33N and a molecular weight of 287.49 g/mol. Its IUPAC name is 3-(4,5-dimethylheptan-2-yl)-3,4-dimethyl-5-penta-1,4-dien-2-ylpyrrole.
| Compound Name | 3-(4,5-dimethylheptan-2-yl)-3,4-dimethyl-5-penta-1,4-dien-2-ylpyrrole |
|---|---|
| PubChem CID | 154999871 |
| Molecular Formula | C20H33N |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | 3-(4,5-dimethylheptan-2-yl)-3,4-dimethyl-5-penta-1,4-dien-2-ylpyrrole |
| SMILES | C=CCC(=C)C1=C(C)C(C)(C(C)CC(C)C(C)CC)C=N1 |
| InChI | InChI=1S/C20H33N/c1-9-11-15(4)19-18(7)20(8,13-21-19)17(6)12-16(5)14(3)10-2/h9,13-14,16-17H,1,4,10-12H2,2-3,5-8H3 |
| InChIKey | NAVCEEILLLLLMS-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|