C15H26F2N2O2 — CID 155000437
(5Z,7Z)-2,2-difluoro-7-methyl-8-(methylamino)-N-(2-propoxyethyl)octa-5,7-dienamide (PubChem CID 155000437) has the molecular formula C15H26F2N2O2 and a molecular weight of 304.38 g/mol. Its IUPAC name is (5Z,7Z)-2,2-difluoro-7-methyl-8-(methylamino)-N-(2-propoxyethyl)octa-5,7-dienamide.
| Compound Name | (5Z,7Z)-2,2-difluoro-7-methyl-8-(methylamino)-N-(2-propoxyethyl)octa-5,7-dienamide |
|---|---|
| PubChem CID | 155000437 |
| Molecular Formula | C15H26F2N2O2 |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (5Z,7Z)-2,2-difluoro-7-methyl-8-(methylamino)-N-(2-propoxyethyl)octa-5,7-dienamide |
| SMILES | CCCOCCNC(=O)C(F)(F)CC/C=C\C(C)=C/NC |
| InChI | InChI=1S/C15H26F2N2O2/c1-4-10-21-11-9-19-14(20)15(16,17)8-6-5-7-13(2)12-18-3/h5,7,12,18H,4,6,8-11H2,1-3H3,(H,19,20)/b7-5-,13-12- |
| InChIKey | HTKYDEFAYSHWHS-TXTXDJJGSA-N |
| XLogP | 2.62 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|