About (E)-N-[(E)-hexa-1,5-dien-3-ylideneamino]pent-3-en-1-amine
(E)-N-[(E)-hexa-1,5-dien-3-ylideneamino]pent-3-en-1-amine (PubChem CID 155000646) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is (E)-N-[(E)-hexa-1,5-dien-3-ylideneamino]pent-3-en-1-amine.
Molecular Properties
| Compound Name | (E)-N-[(E)-hexa-1,5-dien-3-ylideneamino]pent-3-en-1-amine |
| PubChem CID | 155000646 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | (E)-N-[(E)-hexa-1,5-dien-3-ylideneamino]pent-3-en-1-amine |
| SMILES | C=CC/C(C=C)=N\NCC/C=C/C |
| InChI | InChI=1S/C11H18N2/c1-4-7-8-10-12-13-11(6-3)9-5-2/h4-7,12H,2-3,8-10H2,1H3/b7-4+,13-11- |
| InChIKey | DFWNNRROGCXADF-GWVNSSQISA-N |
| XLogP | 2.66 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-[(E)-hexa-1,5-dien-3-ylideneamino]pent-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-[(E)-hexa-1,5-dien-3-ylideneamino]pent-3-en-1-amine?
The IUPAC name of (E)-N-[(E)-hexa-1,5-dien-3-ylideneamino]pent-3-en-1-amine (CID 155000646) is (E)-N-[(E)-hexa-1,5-dien-3-ylideneamino]pent-3-en-1-amine.
What is the SMILES notation for (E)-N-[(E)-hexa-1,5-dien-3-ylideneamino]pent-3-en-1-amine?
The canonical SMILES for (E)-N-[(E)-hexa-1,5-dien-3-ylideneamino]pent-3-en-1-amine is C=CC/C(C=C)=N\NCC/C=C/C.
What is the InChIKey of (E)-N-[(E)-hexa-1,5-dien-3-ylideneamino]pent-3-en-1-amine?
The InChIKey is DFWNNRROGCXADF-GWVNSSQISA-N. The full InChI is InChI=1S/C11H18N2/c1-4-7-8-10-12-13-11(6-3)9-5-2/h4-7,12H,2-3,8-10H2,1H3/b7-4+,13-11-.
What are the key properties of (E)-N-[(E)-hexa-1,5-dien-3-ylideneamino]pent-3-en-1-amine?
(E)-N-[(E)-hexa-1,5-dien-3-ylideneamino]pent-3-en-1-amine has a molecular weight of 178.28 g/mol, XLogP of 2.66, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-[(E)-hexa-1,5-dien-3-ylideneamino]pent-3-en-1-amine is sourced from PubChem (CID 155000646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).