C17H25NO — CID 155000786
(7Z)-1-methyl-2-[[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]oxymethyl]-5,6-dihydro-2H-azocine (PubChem CID 155000786) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is (7Z)-1-methyl-2-[[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]oxymethyl]-5,6-dihydro-2H-azocine.
| Compound Name | (7Z)-1-methyl-2-[[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]oxymethyl]-5,6-dihydro-2H-azocine |
|---|---|
| PubChem CID | 155000786 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | (7Z)-1-methyl-2-[[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]oxymethyl]-5,6-dihydro-2H-azocine |
| SMILES | C=C(C)/C=C\C(=C/C)OCC1C=CCC/C=C\N1C |
| InChI | InChI=1S/C17H25NO/c1-5-17(12-11-15(2)3)19-14-16-10-8-6-7-9-13-18(16)4/h5,8-13,16H,2,6-7,14H2,1,3-4H3/b10-8?,12-11-,13-9-,17-5+ |
| InChIKey | FOYNAXBYYCAMNB-IMASUWSNSA-N |
| XLogP | 4.20 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|