C24H43NS — CID 155000940
1-[4-(5-hexylsulfanyl-2-methylpentyl)cyclohepta-1,3,5-trien-1-yl]-N-methylbutan-2-amine (PubChem CID 155000940) has the molecular formula C24H43NS and a molecular weight of 377.68 g/mol. Its IUPAC name is 1-[4-(5-hexylsulfanyl-2-methylpentyl)cyclohepta-1,3,5-trien-1-yl]-N-methylbutan-2-amine.
| Compound Name | 1-[4-(5-hexylsulfanyl-2-methylpentyl)cyclohepta-1,3,5-trien-1-yl]-N-methylbutan-2-amine |
|---|---|
| PubChem CID | 155000940 |
| Molecular Formula | C24H43NS |
| Molecular Weight | 377.68 g/mol |
| Exact Mass | 377.31 |
| IUPAC Name | 1-[4-(5-hexylsulfanyl-2-methylpentyl)cyclohepta-1,3,5-trien-1-yl]-N-methylbutan-2-amine |
| SMILES | CCCCCCSCCCC(C)CC1=CC=C(CC(CC)NC)CC=C1 |
| InChI | InChI=1S/C24H43NS/c1-5-7-8-9-17-26-18-11-12-21(3)19-22-13-10-14-23(16-15-22)20-24(6-2)25-4/h10,13,15-16,21,24-25H,5-9,11-12,14,17-20H2,1-4H3 |
| InChIKey | IRTKXEIVXFBKFA-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.68 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|