About 1,2,3-trimethyl-6-(trifluoromethyl)-3,6-dihydropyridazine
1,2,3-trimethyl-6-(trifluoromethyl)-3,6-dihydropyridazine (PubChem CID 155001342) has the molecular formula C8H13F3N2
and a molecular weight of 194.20 g/mol. Its IUPAC name is 1,2,3-trimethyl-6-(trifluoromethyl)-3,6-dihydropyridazine.
Molecular Properties
| Compound Name | 1,2,3-trimethyl-6-(trifluoromethyl)-3,6-dihydropyridazine |
| PubChem CID | 155001342 |
| Molecular Formula | C8H13F3N2 |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | 1,2,3-trimethyl-6-(trifluoromethyl)-3,6-dihydropyridazine |
| SMILES | CC1C=CC(C(F)(F)F)N(C)N1C |
| InChI | InChI=1S/C8H13F3N2/c1-6-4-5-7(8(9,10)11)13(3)12(6)2/h4-7H,1-3H3 |
| InChIKey | OQTILLLUPPWNLB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,2,3-trimethyl-6-(trifluoromethyl)-3,6-dihydropyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-trimethyl-6-(trifluoromethyl)-3,6-dihydropyridazine?
The IUPAC name of 1,2,3-trimethyl-6-(trifluoromethyl)-3,6-dihydropyridazine (CID 155001342) is 1,2,3-trimethyl-6-(trifluoromethyl)-3,6-dihydropyridazine.
What is the SMILES notation for 1,2,3-trimethyl-6-(trifluoromethyl)-3,6-dihydropyridazine?
The canonical SMILES for 1,2,3-trimethyl-6-(trifluoromethyl)-3,6-dihydropyridazine is CC1C=CC(C(F)(F)F)N(C)N1C.
What is the InChIKey of 1,2,3-trimethyl-6-(trifluoromethyl)-3,6-dihydropyridazine?
The InChIKey is OQTILLLUPPWNLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F3N2/c1-6-4-5-7(8(9,10)11)13(3)12(6)2/h4-7H,1-3H3.
What are the key properties of 1,2,3-trimethyl-6-(trifluoromethyl)-3,6-dihydropyridazine?
1,2,3-trimethyl-6-(trifluoromethyl)-3,6-dihydropyridazine has a molecular weight of 194.20 g/mol, XLogP of 1.65, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-trimethyl-6-(trifluoromethyl)-3,6-dihydropyridazine is sourced from PubChem (CID 155001342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).