C20H25N7O4S2 — CID 155001447
5-N-ethyl-8-N-[4-[methylsulfanyl(methylsulfonyl)amino]-2-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 155001447) has the molecular formula C20H25N7O4S2 and a molecular weight of 491.60 g/mol. Its IUPAC name is 5-N-ethyl-8-N-[4-[methylsulfanyl(methylsulfonyl)amino]-2-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | 5-N-ethyl-8-N-[4-[methylsulfanyl(methylsulfonyl)amino]-2-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 155001447 |
| Molecular Formula | C20H25N7O4S2 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | 5-N-ethyl-8-N-[4-[methylsulfanyl(methylsulfonyl)amino]-2-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | CCNC(=O)c1ccc2c(n1)N(C(=O)Nc1cc(N(SC)S(C)(=O)=O)ccn1)C1CCN2C1 |
| InChI | InChI=1S/C20H25N7O4S2/c1-4-21-19(28)15-5-6-16-18(23-15)26(14-8-10-25(16)12-14)20(29)24-17-11-13(7-9-22-17)27(32-2)33(3,30)31/h5-7,9,11,14H,4,8,10,12H2,1-3H3,(H,21,28)(H,22,24,29) |
| InChIKey | BMPCJJTWVCZMHL-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|