C19H21N7O2 — CID 155001580
8-N-(4-cyano-2-pyridinyl)-5-N-ethyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3-diene-5,8-dicarboxamide (PubChem CID 155001580) has the molecular formula C19H21N7O2 and a molecular weight of 379.42 g/mol. Its IUPAC name is 8-N-(4-cyano-2-pyridinyl)-5-N-ethyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3-diene-5,8-dicarboxamide.
| Compound Name | 8-N-(4-cyano-2-pyridinyl)-5-N-ethyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3-diene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 155001580 |
| Molecular Formula | C19H21N7O2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 8-N-(4-cyano-2-pyridinyl)-5-N-ethyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3-diene-5,8-dicarboxamide |
| SMILES | CCNC(=O)C1C=CC2=C(N1)N(C(=O)Nc1cc(C#N)ccn1)C1CCN2C1 |
| InChI | InChI=1S/C19H21N7O2/c1-2-21-18(27)14-3-4-15-17(23-14)26(13-6-8-25(15)11-13)19(28)24-16-9-12(10-20)5-7-22-16/h3-5,7,9,13-14,23H,2,6,8,11H2,1H3,(H,21,27)(H,22,24,28) |
| InChIKey | ZQGIRJOKNNCQME-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |