C14H17F3N4O2 — CID 155001604
8-methyl-N-(1,1,1-trifluoro-3-hydroxypropan-2-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxamide (PubChem CID 155001604) has the molecular formula C14H17F3N4O2 and a molecular weight of 330.31 g/mol. Its IUPAC name is 8-methyl-N-(1,1,1-trifluoro-3-hydroxypropan-2-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxamide.
| Compound Name | 8-methyl-N-(1,1,1-trifluoro-3-hydroxypropan-2-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxamide |
|---|---|
| PubChem CID | 155001604 |
| Molecular Formula | C14H17F3N4O2 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 8-methyl-N-(1,1,1-trifluoro-3-hydroxypropan-2-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxamide |
| SMILES | CN1c2nc(C(=O)NC(CO)C(F)(F)F)ccc2N2CCC1C2 |
| InChI | InChI=1S/C14H17F3N4O2/c1-20-8-4-5-21(6-8)10-3-2-9(18-12(10)20)13(23)19-11(7-22)14(15,16)17/h2-3,8,11,22H,4-7H2,1H3,(H,19,23) |
| InChIKey | NYDOJCUSVPTHTA-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |