C17H29N — CID 155001650
(4Z)-N-[(2R)-3,3-dimethylbutan-2-yl]-6,7-dimethyl-3-methylideneocta-1,4,6-trien-2-amine (PubChem CID 155001650) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is (4Z)-N-[(2R)-3,3-dimethylbutan-2-yl]-6,7-dimethyl-3-methylideneocta-1,4,6-trien-2-amine.
| Compound Name | (4Z)-N-[(2R)-3,3-dimethylbutan-2-yl]-6,7-dimethyl-3-methylideneocta-1,4,6-trien-2-amine |
|---|---|
| PubChem CID | 155001650 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | (4Z)-N-[(2R)-3,3-dimethylbutan-2-yl]-6,7-dimethyl-3-methylideneocta-1,4,6-trien-2-amine |
| SMILES | C=C(/C=C\C(C)=C(C)C)C(=C)N[C@H](C)C(C)(C)C |
| InChI | InChI=1S/C17H29N/c1-12(2)13(3)10-11-14(4)15(5)18-16(6)17(7,8)9/h10-11,16,18H,4-5H2,1-3,6-9H3/b11-10-/t16-/m1/s1 |
| InChIKey | YPFMJXAPUABGGZ-BLIJAFNYSA-N |
| XLogP | 4.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|