C20H21N5 — CID 155001673
N-[1-(5-but-2-ynyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-8-yl)ethenyl]pyridin-2-amine (PubChem CID 155001673) has the molecular formula C20H21N5 and a molecular weight of 331.42 g/mol. Its IUPAC name is N-[1-(5-but-2-ynyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-8-yl)ethenyl]pyridin-2-amine.
| Compound Name | N-[1-(5-but-2-ynyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-8-yl)ethenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 155001673 |
| Molecular Formula | C20H21N5 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | N-[1-(5-but-2-ynyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-8-yl)ethenyl]pyridin-2-amine |
| SMILES | C=C(Nc1ccccn1)N1c2nc(CC#CC)ccc2N2CCC1C2 |
| InChI | InChI=1S/C20H21N5/c1-3-4-7-16-9-10-18-20(23-16)25(17-11-13-24(18)14-17)15(2)22-19-8-5-6-12-21-19/h5-6,8-10,12,17H,2,7,11,13-14H2,1H3,(H,21,22) |
| InChIKey | DRMLJGDJSCUXNN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|