C21H18F3N7O2 — CID 155001709
(9S)-N-(5-cyano-2-pyridinyl)-5-(5,5,5-trifluoro-3-iminopentanoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 155001709) has the molecular formula C21H18F3N7O2 and a molecular weight of 457.42 g/mol. Its IUPAC name is (9S)-N-(5-cyano-2-pyridinyl)-5-(5,5,5-trifluoro-3-iminopentanoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-(5-cyano-2-pyridinyl)-5-(5,5,5-trifluoro-3-iminopentanoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 155001709 |
| Molecular Formula | C21H18F3N7O2 |
| Molecular Weight | 457.42 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | (9S)-N-(5-cyano-2-pyridinyl)-5-(5,5,5-trifluoro-3-iminopentanoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | [H]/N=C(/CC(=O)c1ccc2c(n1)N(C(=O)Nc1ccc(C#N)cn1)[C@H]1CCN2C1)CC(F)(F)F |
| InChI | InChI=1S/C21H18F3N7O2/c22-21(23,24)8-13(26)7-17(32)15-2-3-16-19(28-15)31(14-5-6-30(16)11-14)20(33)29-18-4-1-12(9-25)10-27-18/h1-4,10,14,26H,5-8,11H2,(H,27,29,33)/b26-13-/t14-/m0/s1 |
| InChIKey | IMVXIIGKSPKRIP-ASBHVJNYSA-N |
| XLogP | 3.52 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|