C14H24N2 — CID 155001739
(E,5S)-N,5-dimethyl-4-methylidene-6-methylimino-2-[(Z)-prop-1-enyl]hept-2-en-1-amine (PubChem CID 155001739) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is (E,5S)-N,5-dimethyl-4-methylidene-6-methylimino-2-[(Z)-prop-1-enyl]hept-2-en-1-amine.
| Compound Name | (E,5S)-N,5-dimethyl-4-methylidene-6-methylimino-2-[(Z)-prop-1-enyl]hept-2-en-1-amine |
|---|---|
| PubChem CID | 155001739 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | (E,5S)-N,5-dimethyl-4-methylidene-6-methylimino-2-[(Z)-prop-1-enyl]hept-2-en-1-amine |
| SMILES | C=C(/C=C(\C=C/C)CNC)[C@H](C)/C(C)=N/C |
| InChI | InChI=1S/C14H24N2/c1-7-8-14(10-15-5)9-11(2)12(3)13(4)16-6/h7-9,12,15H,2,10H2,1,3-6H3/b8-7-,14-9+,16-13+/t12-/m0/s1 |
| InChIKey | UCERCDNBLDAIMQ-ACNCHSPCSA-N |
| XLogP | 2.99 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|