C21H36FN — CID 155002025
(3E,5Z)-N-(2-fluoro-2-methylpropyl)-3,9-dimethyl-6-prop-1-en-2-yldodeca-1,3,5-trien-2-amine (PubChem CID 155002025) has the molecular formula C21H36FN and a molecular weight of 321.52 g/mol. Its IUPAC name is (3E,5Z)-N-(2-fluoro-2-methylpropyl)-3,9-dimethyl-6-prop-1-en-2-yldodeca-1,3,5-trien-2-amine.
| Compound Name | (3E,5Z)-N-(2-fluoro-2-methylpropyl)-3,9-dimethyl-6-prop-1-en-2-yldodeca-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 155002025 |
| Molecular Formula | C21H36FN |
| Molecular Weight | 321.52 g/mol |
| Exact Mass | 321.28 |
| IUPAC Name | (3E,5Z)-N-(2-fluoro-2-methylpropyl)-3,9-dimethyl-6-prop-1-en-2-yldodeca-1,3,5-trien-2-amine |
| SMILES | C=C(C)/C(=C\C=C(/C)C(=C)NCC(C)(C)F)CCC(C)CCC |
| InChI | InChI=1S/C21H36FN/c1-9-10-17(4)11-13-20(16(2)3)14-12-18(5)19(6)23-15-21(7,8)22/h12,14,17,23H,2,6,9-11,13,15H2,1,3-5,7-8H3/b18-12+,20-14- |
| InChIKey | IBQJIWOIHCAJCN-HVBZWIGSSA-N |
| XLogP | 6.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.52 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|