C28H56OS2 — CID 155002047
3,3,7-trimethyl-1-[2-[2-methyl-4-(2-methyl-4-methylideneheptan-2-yl)sulfanylpentan-2-yl]sulfanylethoxy]octane (PubChem CID 155002047) has the molecular formula C28H56OS2 and a molecular weight of 472.89 g/mol. Its IUPAC name is 3,3,7-trimethyl-1-[2-[2-methyl-4-(2-methyl-4-methylideneheptan-2-yl)sulfanylpentan-2-yl]sulfanylethoxy]octane.
| Compound Name | 3,3,7-trimethyl-1-[2-[2-methyl-4-(2-methyl-4-methylideneheptan-2-yl)sulfanylpentan-2-yl]sulfanylethoxy]octane |
|---|---|
| PubChem CID | 155002047 |
| Molecular Formula | C28H56OS2 |
| Molecular Weight | 472.89 g/mol |
| Exact Mass | 472.38 |
| IUPAC Name | 3,3,7-trimethyl-1-[2-[2-methyl-4-(2-methyl-4-methylideneheptan-2-yl)sulfanylpentan-2-yl]sulfanylethoxy]octane |
| SMILES | C=C(CCC)CC(C)(C)SC(C)CC(C)(C)SCCOCCC(C)(C)CCCC(C)C |
| InChI | InChI=1S/C28H56OS2/c1-12-14-24(4)21-28(10,11)31-25(5)22-27(8,9)30-20-19-29-18-17-26(6,7)16-13-15-23(2)3/h23,25H,4,12-22H2,1-3,5-11H3 |
| InChIKey | ITUMLVHRWJGKNP-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.89 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|