About 3-buta-1,3-dien-2-ylsulfanyl-N,2-dimethylpropan-1-amine
3-buta-1,3-dien-2-ylsulfanyl-N,2-dimethylpropan-1-amine (PubChem CID 155002060) has the molecular formula C9H17NS
and a molecular weight of 171.31 g/mol. Its IUPAC name is 3-buta-1,3-dien-2-ylsulfanyl-N,2-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-buta-1,3-dien-2-ylsulfanyl-N,2-dimethylpropan-1-amine |
| PubChem CID | 155002060 |
| Molecular Formula | C9H17NS |
| Molecular Weight | 171.31 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | 3-buta-1,3-dien-2-ylsulfanyl-N,2-dimethylpropan-1-amine |
| SMILES | C=CC(=C)SCC(C)CNC |
| InChI | InChI=1S/C9H17NS/c1-5-9(3)11-7-8(2)6-10-4/h5,8,10H,1,3,6-7H2,2,4H3 |
| InChIKey | ZGNOFAXZDBWZMQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-buta-1,3-dien-2-ylsulfanyl-N,2-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-buta-1,3-dien-2-ylsulfanyl-N,2-dimethylpropan-1-amine?
The IUPAC name of 3-buta-1,3-dien-2-ylsulfanyl-N,2-dimethylpropan-1-amine (CID 155002060) is 3-buta-1,3-dien-2-ylsulfanyl-N,2-dimethylpropan-1-amine.
What is the SMILES notation for 3-buta-1,3-dien-2-ylsulfanyl-N,2-dimethylpropan-1-amine?
The canonical SMILES for 3-buta-1,3-dien-2-ylsulfanyl-N,2-dimethylpropan-1-amine is C=CC(=C)SCC(C)CNC.
What is the InChIKey of 3-buta-1,3-dien-2-ylsulfanyl-N,2-dimethylpropan-1-amine?
The InChIKey is ZGNOFAXZDBWZMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NS/c1-5-9(3)11-7-8(2)6-10-4/h5,8,10H,1,3,6-7H2,2,4H3.
What are the key properties of 3-buta-1,3-dien-2-ylsulfanyl-N,2-dimethylpropan-1-amine?
3-buta-1,3-dien-2-ylsulfanyl-N,2-dimethylpropan-1-amine has a molecular weight of 171.31 g/mol, XLogP of 2.27, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-buta-1,3-dien-2-ylsulfanyl-N,2-dimethylpropan-1-amine is sourced from PubChem (CID 155002060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).