C20H21F2N5O3 — CID 155002089
2,2-difluorobutyl (9S)-8-(pyridin-2-ylcarbamoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylate (PubChem CID 155002089) has the molecular formula C20H21F2N5O3 and a molecular weight of 417.42 g/mol. Its IUPAC name is 2,2-difluorobutyl (9S)-8-(pyridin-2-ylcarbamoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylate.
| Compound Name | 2,2-difluorobutyl (9S)-8-(pyridin-2-ylcarbamoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylate |
|---|---|
| PubChem CID | 155002089 |
| Molecular Formula | C20H21F2N5O3 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 2,2-difluorobutyl (9S)-8-(pyridin-2-ylcarbamoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5-carboxylate |
| SMILES | CCC(F)(F)COC(=O)c1ccc2c(n1)N(C(=O)Nc1ccccn1)[C@H]1CCN2C1 |
| InChI | InChI=1S/C20H21F2N5O3/c1-2-20(21,22)12-30-18(28)14-6-7-15-17(24-14)27(13-8-10-26(15)11-13)19(29)25-16-5-3-4-9-23-16/h3-7,9,13H,2,8,10-12H2,1H3,(H,23,25,29)/t13-/m0/s1 |
| InChIKey | UPTPCFNWXLGESM-ZDUSSCGKSA-N |
| XLogP | 3.31 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |