C20H33FN2 — CID 155002126
(3E,5E)-N-(3-fluoro-3-methylbutan-2-yl)-3,7-dimethyl-6-(3-methylpyrrolidin-1-yl)octa-1,3,5,7-tetraen-2-amine (PubChem CID 155002126) has the molecular formula C20H33FN2 and a molecular weight of 320.50 g/mol. Its IUPAC name is (3E,5E)-N-(3-fluoro-3-methylbutan-2-yl)-3,7-dimethyl-6-(3-methylpyrrolidin-1-yl)octa-1,3,5,7-tetraen-2-amine.
| Compound Name | (3E,5E)-N-(3-fluoro-3-methylbutan-2-yl)-3,7-dimethyl-6-(3-methylpyrrolidin-1-yl)octa-1,3,5,7-tetraen-2-amine |
|---|---|
| PubChem CID | 155002126 |
| Molecular Formula | C20H33FN2 |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.26 |
| IUPAC Name | (3E,5E)-N-(3-fluoro-3-methylbutan-2-yl)-3,7-dimethyl-6-(3-methylpyrrolidin-1-yl)octa-1,3,5,7-tetraen-2-amine |
| SMILES | C=C(NC(C)C(C)(C)F)/C(C)=C/C=C(\C(=C)C)N1CCC(C)C1 |
| InChI | InChI=1S/C20H33FN2/c1-14(2)19(23-12-11-15(3)13-23)10-9-16(4)17(5)22-18(6)20(7,8)21/h9-10,15,18,22H,1,5,11-13H2,2-4,6-8H3/b16-9+,19-10+ |
| InChIKey | KPOAHLWUCQZMMD-JGAKURLYSA-N |
| XLogP | 4.97 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|