C29H59NS2 — CID 155002156
N,2,6-trimethyl-11-[2-methyl-4-(2-methyl-4-methylideneheptan-2-yl)sulfanylpentan-2-yl]sulfanylundecan-2-amine (PubChem CID 155002156) has the molecular formula C29H59NS2 and a molecular weight of 485.93 g/mol. Its IUPAC name is N,2,6-trimethyl-11-[2-methyl-4-(2-methyl-4-methylideneheptan-2-yl)sulfanylpentan-2-yl]sulfanylundecan-2-amine.
| Compound Name | N,2,6-trimethyl-11-[2-methyl-4-(2-methyl-4-methylideneheptan-2-yl)sulfanylpentan-2-yl]sulfanylundecan-2-amine |
|---|---|
| PubChem CID | 155002156 |
| Molecular Formula | C29H59NS2 |
| Molecular Weight | 485.93 g/mol |
| Exact Mass | 485.41 |
| IUPAC Name | N,2,6-trimethyl-11-[2-methyl-4-(2-methyl-4-methylideneheptan-2-yl)sulfanylpentan-2-yl]sulfanylundecan-2-amine |
| SMILES | C=C(CCC)CC(C)(C)SC(C)CC(C)(C)SCCCCCC(C)CCCC(C)(C)NC |
| InChI | InChI=1S/C29H59NS2/c1-12-17-25(3)22-29(9,10)32-26(4)23-28(7,8)31-21-15-13-14-18-24(2)19-16-20-27(5,6)30-11/h24,26,30H,3,12-23H2,1-2,4-11H3 |
| InChIKey | DKCWBQCMLUTIIN-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.93 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|