About (1Z)-3-N-ethyl-2-methyl-1-(methylideneamino)buta-1,3-diene-1,3-diamine
(1Z)-3-N-ethyl-2-methyl-1-(methylideneamino)buta-1,3-diene-1,3-diamine (PubChem CID 155002534) has the molecular formula C8H15N3
and a molecular weight of 153.23 g/mol. Its IUPAC name is (1Z)-3-N-ethyl-2-methyl-1-(methylideneamino)buta-1,3-diene-1,3-diamine.
Molecular Properties
| Compound Name | (1Z)-3-N-ethyl-2-methyl-1-(methylideneamino)buta-1,3-diene-1,3-diamine |
| PubChem CID | 155002534 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | (1Z)-3-N-ethyl-2-methyl-1-(methylideneamino)buta-1,3-diene-1,3-diamine |
| SMILES | C=N/C(N)=C(/C)C(=C)NCC |
| InChI | InChI=1S/C8H15N3/c1-5-11-7(3)6(2)8(9)10-4/h11H,3-5,9H2,1-2H3/b8-6- |
| InChIKey | BJTCIUFSACBWAS-VURMDHGXSA-N |
| XLogP | 1.00 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-3-N-ethyl-2-methyl-1-(methylideneamino)buta-1,3-diene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-3-N-ethyl-2-methyl-1-(methylideneamino)buta-1,3-diene-1,3-diamine?
The IUPAC name of (1Z)-3-N-ethyl-2-methyl-1-(methylideneamino)buta-1,3-diene-1,3-diamine (CID 155002534) is (1Z)-3-N-ethyl-2-methyl-1-(methylideneamino)buta-1,3-diene-1,3-diamine.
What is the SMILES notation for (1Z)-3-N-ethyl-2-methyl-1-(methylideneamino)buta-1,3-diene-1,3-diamine?
The canonical SMILES for (1Z)-3-N-ethyl-2-methyl-1-(methylideneamino)buta-1,3-diene-1,3-diamine is C=N/C(N)=C(/C)C(=C)NCC.
What is the InChIKey of (1Z)-3-N-ethyl-2-methyl-1-(methylideneamino)buta-1,3-diene-1,3-diamine?
The InChIKey is BJTCIUFSACBWAS-VURMDHGXSA-N. The full InChI is InChI=1S/C8H15N3/c1-5-11-7(3)6(2)8(9)10-4/h11H,3-5,9H2,1-2H3/b8-6-.
What are the key properties of (1Z)-3-N-ethyl-2-methyl-1-(methylideneamino)buta-1,3-diene-1,3-diamine?
(1Z)-3-N-ethyl-2-methyl-1-(methylideneamino)buta-1,3-diene-1,3-diamine has a molecular weight of 153.23 g/mol, XLogP of 1.00, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-3-N-ethyl-2-methyl-1-(methylideneamino)buta-1,3-diene-1,3-diamine is sourced from PubChem (CID 155002534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).