About (2Z,4E)-4-[2-(dimethylamino)phenyl]-5-phenylpenta-2,4-dienenitrile
(2Z,4E)-4-[2-(dimethylamino)phenyl]-5-phenylpenta-2,4-dienenitrile (PubChem CID 155002673) has the molecular formula C19H18N2
and a molecular weight of 274.37 g/mol. Its IUPAC name is (2Z,4E)-4-[2-(dimethylamino)phenyl]-5-phenylpenta-2,4-dienenitrile.
Molecular Properties
| Compound Name | (2Z,4E)-4-[2-(dimethylamino)phenyl]-5-phenylpenta-2,4-dienenitrile |
| PubChem CID | 155002673 |
| Molecular Formula | C19H18N2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | (2Z,4E)-4-[2-(dimethylamino)phenyl]-5-phenylpenta-2,4-dienenitrile |
| SMILES | CN(C)c1ccccc1C(/C=C\C#N)=C/c1ccccc1 |
| InChI | InChI=1S/C19H18N2/c1-21(2)19-13-7-6-12-18(19)17(11-8-14-20)15-16-9-4-3-5-10-16/h3-13,15H,1-2H3/b11-8-,17-15+ |
| InChIKey | AFNHMKDQNCYHPA-XYWKCAQWSA-N |
| XLogP | 4.37 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4E)-4-[2-(dimethylamino)phenyl]-5-phenylpenta-2,4-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4E)-4-[2-(dimethylamino)phenyl]-5-phenylpenta-2,4-dienenitrile?
The IUPAC name of (2Z,4E)-4-[2-(dimethylamino)phenyl]-5-phenylpenta-2,4-dienenitrile (CID 155002673) is (2Z,4E)-4-[2-(dimethylamino)phenyl]-5-phenylpenta-2,4-dienenitrile.
What is the SMILES notation for (2Z,4E)-4-[2-(dimethylamino)phenyl]-5-phenylpenta-2,4-dienenitrile?
The canonical SMILES for (2Z,4E)-4-[2-(dimethylamino)phenyl]-5-phenylpenta-2,4-dienenitrile is CN(C)c1ccccc1C(/C=C\C#N)=C/c1ccccc1.
What is the InChIKey of (2Z,4E)-4-[2-(dimethylamino)phenyl]-5-phenylpenta-2,4-dienenitrile?
The InChIKey is AFNHMKDQNCYHPA-XYWKCAQWSA-N. The full InChI is InChI=1S/C19H18N2/c1-21(2)19-13-7-6-12-18(19)17(11-8-14-20)15-16-9-4-3-5-10-16/h3-13,15H,1-2H3/b11-8-,17-15+.
What are the key properties of (2Z,4E)-4-[2-(dimethylamino)phenyl]-5-phenylpenta-2,4-dienenitrile?
(2Z,4E)-4-[2-(dimethylamino)phenyl]-5-phenylpenta-2,4-dienenitrile has a molecular weight of 274.37 g/mol, XLogP of 4.37, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4E)-4-[2-(dimethylamino)phenyl]-5-phenylpenta-2,4-dienenitrile is sourced from PubChem (CID 155002673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).