C13H20F3NS — CID 155004047
N-tert-butylsulfanyl-1-cyclohexa-1,5-dien-1-yl-3,3,3-trifluoropropan-1-amine (PubChem CID 155004047) has the molecular formula C13H20F3NS and a molecular weight of 279.37 g/mol. Its IUPAC name is N-tert-butylsulfanyl-1-cyclohexa-1,5-dien-1-yl-3,3,3-trifluoropropan-1-amine.
| Compound Name | N-tert-butylsulfanyl-1-cyclohexa-1,5-dien-1-yl-3,3,3-trifluoropropan-1-amine |
|---|---|
| PubChem CID | 155004047 |
| Molecular Formula | C13H20F3NS |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | N-tert-butylsulfanyl-1-cyclohexa-1,5-dien-1-yl-3,3,3-trifluoropropan-1-amine |
| SMILES | CC(C)(C)SNC(CC(F)(F)F)C1=CCCC=C1 |
| InChI | InChI=1S/C13H20F3NS/c1-12(2,3)18-17-11(9-13(14,15)16)10-7-5-4-6-8-10/h5,7-8,11,17H,4,6,9H2,1-3H3 |
| InChIKey | KWIFESOGQNLUNH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|