C32H37ClFN3O4 — CID 155004103
2-[(3E,5Z)-6-chloro-3-(6-fluoro-5-methoxy-1H-benzimidazol-2-yl)hexa-1,3,5-trien-2-yl]-5-(1-cyclohexylbutylcarbamoyl)cyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 155004103) has the molecular formula C32H37ClFN3O4 and a molecular weight of 582.12 g/mol. Its IUPAC name is 2-[(3E,5Z)-6-chloro-3-(6-fluoro-5-methoxy-1H-benzimidazol-2-yl)hexa-1,3,5-trien-2-yl]-5-(1-cyclohexylbutylcarbamoyl)cyclohexa-1,5-diene-1-carboxylic acid.
| Compound Name | 2-[(3E,5Z)-6-chloro-3-(6-fluoro-5-methoxy-1H-benzimidazol-2-yl)hexa-1,3,5-trien-2-yl]-5-(1-cyclohexylbutylcarbamoyl)cyclohexa-1,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 155004103 |
| Molecular Formula | C32H37ClFN3O4 |
| Molecular Weight | 582.12 g/mol |
| Exact Mass | 581.25 |
| IUPAC Name | 2-[(3E,5Z)-6-chloro-3-(6-fluoro-5-methoxy-1H-benzimidazol-2-yl)hexa-1,3,5-trien-2-yl]-5-(1-cyclohexylbutylcarbamoyl)cyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | C=C(C1=C(C(=O)O)C=C(C(=O)NC(CCC)C2CCCCC2)CC1)/C(=C\C=C/Cl)c1nc2cc(OC)c(F)cc2[nH]1 |
| InChI | InChI=1S/C32H37ClFN3O4/c1-4-9-26(20-10-6-5-7-11-20)37-31(38)21-13-14-22(24(16-21)32(39)40)19(2)23(12-8-15-33)30-35-27-17-25(34)29(41-3)18-28(27)36-30/h8,12,15-18,20,26H,2,4-7,9-11,13-14H2,1,3H3,(H,35,36)(H,37,38)(H,39,40)/b15-8-,23-12+ |
| InChIKey | IQGFVFQDIOSLND-ALBKFLLMSA-N |
| XLogP | 7.37 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.12 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|