C14H22F3NS — CID 155004399
N-tert-butylsulfanyl-1-cyclohexa-1,5-dien-1-yl-4,4,4-trifluorobutan-1-amine (PubChem CID 155004399) has the molecular formula C14H22F3NS and a molecular weight of 293.40 g/mol. Its IUPAC name is N-tert-butylsulfanyl-1-cyclohexa-1,5-dien-1-yl-4,4,4-trifluorobutan-1-amine.
| Compound Name | N-tert-butylsulfanyl-1-cyclohexa-1,5-dien-1-yl-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 155004399 |
| Molecular Formula | C14H22F3NS |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | N-tert-butylsulfanyl-1-cyclohexa-1,5-dien-1-yl-4,4,4-trifluorobutan-1-amine |
| SMILES | CC(C)(C)SNC(CCC(F)(F)F)C1=CCCC=C1 |
| InChI | InChI=1S/C14H22F3NS/c1-13(2,3)19-18-12(9-10-14(15,16)17)11-7-5-4-6-8-11/h5,7-8,12,18H,4,6,9-10H2,1-3H3 |
| InChIKey | GDNHDKBFDZSEOL-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|