C26H22Cl2F4N4O3 — CID 155004445
1-[3-[4-(3,4-dichloro-2-fluoroanilino)-7-(2,2,2-trifluoroethoxy)quinazolin-6-yl]oxy-8-azabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one (PubChem CID 155004445) has the molecular formula C26H22Cl2F4N4O3 and a molecular weight of 585.39 g/mol. Its IUPAC name is 1-[3-[4-(3,4-dichloro-2-fluoroanilino)-7-(2,2,2-trifluoroethoxy)quinazolin-6-yl]oxy-8-azabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[4-(3,4-dichloro-2-fluoroanilino)-7-(2,2,2-trifluoroethoxy)quinazolin-6-yl]oxy-8-azabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155004445 |
| Molecular Formula | C26H22Cl2F4N4O3 |
| Molecular Weight | 585.39 g/mol |
| Exact Mass | 584.10 |
| IUPAC Name | 1-[3-[4-(3,4-dichloro-2-fluoroanilino)-7-(2,2,2-trifluoroethoxy)quinazolin-6-yl]oxy-8-azabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C2CCC1CC(Oc1cc3c(Nc4ccc(Cl)c(Cl)c4F)ncnc3cc1OCC(F)(F)F)C2 |
| InChI | InChI=1S/C26H22Cl2F4N4O3/c1-2-22(37)36-13-3-4-14(36)8-15(7-13)39-21-9-16-19(10-20(21)38-11-26(30,31)32)33-12-34-25(16)35-18-6-5-17(27)23(28)24(18)29/h2,5-6,9-10,12-15H,1,3-4,7-8,11H2,(H,33,34,35) |
| InChIKey | IXNKMQJGIFYZNW-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.39 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|