C20H28N2 — CID 155004453
(2E,4Z)-N-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-2-[(Z)-prop-1-enyl]-N-[(Z)-propylideneamino]hexa-2,4-dien-1-amine (PubChem CID 155004453) has the molecular formula C20H28N2 and a molecular weight of 296.46 g/mol. Its IUPAC name is (2E,4Z)-N-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-2-[(Z)-prop-1-enyl]-N-[(Z)-propylideneamino]hexa-2,4-dien-1-amine.
| Compound Name | (2E,4Z)-N-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-2-[(Z)-prop-1-enyl]-N-[(Z)-propylideneamino]hexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 155004453 |
| Molecular Formula | C20H28N2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | (2E,4Z)-N-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-2-[(Z)-prop-1-enyl]-N-[(Z)-propylideneamino]hexa-2,4-dien-1-amine |
| SMILES | C=C/C=C\C(=C/C=C)N(CC(/C=C\C)=C/C=C\C)/N=C\CC |
| InChI | InChI=1S/C20H28N2/c1-6-11-15-19(13-8-3)18-22(21-17-10-5)20(14-9-4)16-12-7-2/h6-9,11-17H,2,4,10,18H2,1,3,5H3/b11-6-,13-8-,16-12-,19-15+,20-14+,21-17- |
| InChIKey | FFIQKJMNBKNUPN-PHQRJTLBSA-N |
| XLogP | 5.57 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|