C17H17Cl2N5O3 — CID 155004590
5-[5-(3,4-dichloro-N-methylanilino)-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-1-yl]pentanoic acid (PubChem CID 155004590) has the molecular formula C17H17Cl2N5O3 and a molecular weight of 410.26 g/mol. Its IUPAC name is 5-[5-(3,4-dichloro-N-methylanilino)-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-1-yl]pentanoic acid.
| Compound Name | 5-[5-(3,4-dichloro-N-methylanilino)-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 155004590 |
| Molecular Formula | C17H17Cl2N5O3 |
| Molecular Weight | 410.26 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 5-[5-(3,4-dichloro-N-methylanilino)-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-1-yl]pentanoic acid |
| SMILES | CN(c1ccc(Cl)c(Cl)c1)c1nc2cnn(CCCCC(=O)O)c2c(=O)[nH]1 |
| InChI | InChI=1S/C17H17Cl2N5O3/c1-23(10-5-6-11(18)12(19)8-10)17-21-13-9-20-24(15(13)16(27)22-17)7-3-2-4-14(25)26/h5-6,8-9H,2-4,7H2,1H3,(H,25,26)(H,21,22,27) |
| InChIKey | CEIZMKIRQYSNQZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.26 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|