C17H19ClFN5O3 — CID 155004628
5-(4-chloro-N,3-dimethylanilino)-3-fluoro-1-[2-(2-hydroxyethoxy)ethyl]-6H-pyrazolo[4,5-d]pyrimidin-7-one (PubChem CID 155004628) has the molecular formula C17H19ClFN5O3 and a molecular weight of 395.82 g/mol. Its IUPAC name is 5-(4-chloro-N,3-dimethylanilino)-3-fluoro-1-[2-(2-hydroxyethoxy)ethyl]-6H-pyrazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 5-(4-chloro-N,3-dimethylanilino)-3-fluoro-1-[2-(2-hydroxyethoxy)ethyl]-6H-pyrazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 155004628 |
| Molecular Formula | C17H19ClFN5O3 |
| Molecular Weight | 395.82 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 5-(4-chloro-N,3-dimethylanilino)-3-fluoro-1-[2-(2-hydroxyethoxy)ethyl]-6H-pyrazolo[4,5-d]pyrimidin-7-one |
| SMILES | Cc1cc(N(C)c2nc3c(F)nn(CCOCCO)c3c(=O)[nH]2)ccc1Cl |
| InChI | InChI=1S/C17H19ClFN5O3/c1-10-9-11(3-4-12(10)18)23(2)17-20-13-14(16(26)21-17)24(22-15(13)19)5-7-27-8-6-25/h3-4,9,25H,5-8H2,1-2H3,(H,20,21,26) |
| InChIKey | ISYIWQOFDXJBHH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.82 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|