About 6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-5-ol
6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-5-ol (PubChem CID 155004666) has the molecular formula C7H8N2O
and a molecular weight of 136.15 g/mol. Its IUPAC name is 6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-5-ol.
Molecular Properties
| Compound Name | 6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-5-ol |
| PubChem CID | 155004666 |
| Molecular Formula | C7H8N2O |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | 6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-5-ol |
| SMILES | OC1NCc2ncccc21 |
| InChI | InChI=1S/C7H8N2O/c10-7-5-2-1-3-8-6(5)4-9-7/h1-3,7,9-10H,4H2 |
| InChIKey | OYVYLOCLNQKFLM-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-5-ol?
The IUPAC name of 6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-5-ol (CID 155004666) is 6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-5-ol.
What is the SMILES notation for 6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-5-ol?
The canonical SMILES for 6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-5-ol is OC1NCc2ncccc21.
What is the InChIKey of 6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-5-ol?
The InChIKey is OYVYLOCLNQKFLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O/c10-7-5-2-1-3-8-6(5)4-9-7/h1-3,7,9-10H,4H2.
What are the key properties of 6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-5-ol?
6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-5-ol has a molecular weight of 136.15 g/mol, XLogP of 0.18, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-5-ol is sourced from PubChem (CID 155004666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).