C36H27ClO — CID 155005088
4-chloro-2-(9,9-dimethylfluoren-2-yl)-7,7-dimethylfluoreno[4,3-b][1]benzofuran (PubChem CID 155005088) has the molecular formula C36H27ClO and a molecular weight of 511.06 g/mol. Its IUPAC name is 4-chloro-2-(9,9-dimethylfluoren-2-yl)-7,7-dimethylfluoreno[4,3-b][1]benzofuran.
| Compound Name | 4-chloro-2-(9,9-dimethylfluoren-2-yl)-7,7-dimethylfluoreno[4,3-b][1]benzofuran |
|---|---|
| PubChem CID | 155005088 |
| Molecular Formula | C36H27ClO |
| Molecular Weight | 511.06 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | 4-chloro-2-(9,9-dimethylfluoren-2-yl)-7,7-dimethylfluoreno[4,3-b][1]benzofuran |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3cc(Cl)c4c(c3)oc3c5c(ccc34)C(C)(C)c3ccccc3-5)cc21 |
| InChI | InChI=1S/C36H27ClO/c1-35(2)27-12-8-6-10-24(27)32-28(35)16-15-25-33-30(37)18-21(19-31(33)38-34(25)32)20-13-14-23-22-9-5-7-11-26(22)36(3,4)29(23)17-20/h5-19H,1-4H3 |
| InChIKey | NQADANPGODGXMQ-UHFFFAOYSA-N |
| XLogP | 10.52 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.06 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |