About [(5,6-difluoro-1H-indol-3-yl)amino]-[6-(trifluoromethyl)-3-pyridinyl]methanol
[(5,6-difluoro-1H-indol-3-yl)amino]-[6-(trifluoromethyl)-3-pyridinyl]methanol (PubChem CID 155005390) has the molecular formula C15H10F5N3O
and a molecular weight of 343.26 g/mol. Its IUPAC name is [(5,6-difluoro-1H-indol-3-yl)amino]-[6-(trifluoromethyl)-3-pyridinyl]methanol.
Molecular Properties
| Compound Name | [(5,6-difluoro-1H-indol-3-yl)amino]-[6-(trifluoromethyl)-3-pyridinyl]methanol |
| PubChem CID | 155005390 |
| Molecular Formula | C15H10F5N3O |
| Molecular Weight | 343.26 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | [(5,6-difluoro-1H-indol-3-yl)amino]-[6-(trifluoromethyl)-3-pyridinyl]methanol |
| SMILES | OC(Nc1c[nH]c2cc(F)c(F)cc12)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C15H10F5N3O/c16-9-3-8-11(4-10(9)17)21-6-12(8)23-14(24)7-1-2-13(22-5-7)15(18,19)20/h1-6,14,21,23-24H |
| InChIKey | QGMRXQINZOTMED-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.26 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [(5,6-difluoro-1H-indol-3-yl)amino]-[6-(trifluoromethyl)-3-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5,6-difluoro-1H-indol-3-yl)amino]-[6-(trifluoromethyl)-3-pyridinyl]methanol?
The IUPAC name of [(5,6-difluoro-1H-indol-3-yl)amino]-[6-(trifluoromethyl)-3-pyridinyl]methanol (CID 155005390) is [(5,6-difluoro-1H-indol-3-yl)amino]-[6-(trifluoromethyl)-3-pyridinyl]methanol.
What is the SMILES notation for [(5,6-difluoro-1H-indol-3-yl)amino]-[6-(trifluoromethyl)-3-pyridinyl]methanol?
The canonical SMILES for [(5,6-difluoro-1H-indol-3-yl)amino]-[6-(trifluoromethyl)-3-pyridinyl]methanol is OC(Nc1c[nH]c2cc(F)c(F)cc12)c1ccc(C(F)(F)F)nc1.
What is the InChIKey of [(5,6-difluoro-1H-indol-3-yl)amino]-[6-(trifluoromethyl)-3-pyridinyl]methanol?
The InChIKey is QGMRXQINZOTMED-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10F5N3O/c16-9-3-8-11(4-10(9)17)21-6-12(8)23-14(24)7-1-2-13(22-5-7)15(18,19)20/h1-6,14,21,23-24H.
What are the key properties of [(5,6-difluoro-1H-indol-3-yl)amino]-[6-(trifluoromethyl)-3-pyridinyl]methanol?
[(5,6-difluoro-1H-indol-3-yl)amino]-[6-(trifluoromethyl)-3-pyridinyl]methanol has a molecular weight of 343.26 g/mol, XLogP of 3.96, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(5,6-difluoro-1H-indol-3-yl)amino]-[6-(trifluoromethyl)-3-pyridinyl]methanol is sourced from PubChem (CID 155005390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).