About 5-methyl-1,2,3,4-tetrahydropyrazine-2-carbonitrile
5-methyl-1,2,3,4-tetrahydropyrazine-2-carbonitrile (PubChem CID 155005618) has the molecular formula C6H9N3
and a molecular weight of 123.16 g/mol. Its IUPAC name is 5-methyl-1,2,3,4-tetrahydropyrazine-2-carbonitrile.
Analyze 5-methyl-1,2,3,4-tetrahydropyrazine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1,2,3,4-tetrahydropyrazine-2-carbonitrile?
The IUPAC name of 5-methyl-1,2,3,4-tetrahydropyrazine-2-carbonitrile (CID 155005618) is 5-methyl-1,2,3,4-tetrahydropyrazine-2-carbonitrile.
What is the SMILES notation for 5-methyl-1,2,3,4-tetrahydropyrazine-2-carbonitrile?
The canonical SMILES for 5-methyl-1,2,3,4-tetrahydropyrazine-2-carbonitrile is CC1=CNC(C#N)CN1.
What is the InChIKey of 5-methyl-1,2,3,4-tetrahydropyrazine-2-carbonitrile?
The InChIKey is AJIPFXLGZKSUNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3/c1-5-3-9-6(2-7)4-8-5/h3,6,8-9H,4H2,1H3.
What are the key properties of 5-methyl-1,2,3,4-tetrahydropyrazine-2-carbonitrile?
5-methyl-1,2,3,4-tetrahydropyrazine-2-carbonitrile has a molecular weight of 123.16 g/mol, XLogP of -0.07, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1,2,3,4-tetrahydropyrazine-2-carbonitrile is sourced from PubChem (CID 155005618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).