C36H32F3N3O5 — CID 155005697
1-[6,8-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-1,4-dioxaspiro[2.5]octan-7-yl]-4-(3,4,5-trifluorophenyl)triazole (PubChem CID 155005697) has the molecular formula C36H32F3N3O5 and a molecular weight of 643.66 g/mol. Its IUPAC name is 1-[6,8-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-1,4-dioxaspiro[2.5]octan-7-yl]-4-(3,4,5-trifluorophenyl)triazole.
| Compound Name | 1-[6,8-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-1,4-dioxaspiro[2.5]octan-7-yl]-4-(3,4,5-trifluorophenyl)triazole |
|---|---|
| PubChem CID | 155005697 |
| Molecular Formula | C36H32F3N3O5 |
| Molecular Weight | 643.66 g/mol |
| Exact Mass | 643.23 |
| IUPAC Name | 1-[6,8-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-1,4-dioxaspiro[2.5]octan-7-yl]-4-(3,4,5-trifluorophenyl)triazole |
| SMILES | Fc1cc(-c2cn(C3C(OCc4ccccc4)C(COCc4ccccc4)OC4(CO4)C3OCc3ccccc3)nn2)cc(F)c1F |
| InChI | InChI=1S/C36H32F3N3O5/c37-28-16-27(17-29(38)32(28)39)30-18-42(41-40-30)33-34(44-20-25-12-6-2-7-13-25)31(22-43-19-24-10-4-1-5-11-24)47-36(23-46-36)35(33)45-21-26-14-8-3-9-15-26/h1-18,31,33-35H,19-23H2 |
| InChIKey | MOXZJRXRFPPFBB-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 80.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.66 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|