C12H18O4 — CID 155005880
(2R,3R)-2-[(E)-prop-1-enyl]-1,4-dioxaspiro[4.5]decane-3-carboxylic acid (PubChem CID 155005880) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is (2R,3R)-2-[(E)-prop-1-enyl]-1,4-dioxaspiro[4.5]decane-3-carboxylic acid.
| Compound Name | (2R,3R)-2-[(E)-prop-1-enyl]-1,4-dioxaspiro[4.5]decane-3-carboxylic acid |
|---|---|
| PubChem CID | 155005880 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (2R,3R)-2-[(E)-prop-1-enyl]-1,4-dioxaspiro[4.5]decane-3-carboxylic acid |
| SMILES | C/C=C/[C@H]1OC2(CCCCC2)O[C@H]1C(=O)O |
| InChI | InChI=1S/C12H18O4/c1-2-6-9-10(11(13)14)16-12(15-9)7-4-3-5-8-12/h2,6,9-10H,3-5,7-8H2,1H3,(H,13,14)/b6-2+/t9-,10-/m1/s1 |
| InChIKey | QQNNUMFWSHKJIH-NXVMTKBZSA-N |
| XLogP | 2.09 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|