C13H20O4 — CID 155005884
(2R,3R)-8-methyl-2-[(E)-prop-1-enyl]-1,4-dioxaspiro[4.5]decane-3-carboxylic acid (PubChem CID 155005884) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is (2R,3R)-8-methyl-2-[(E)-prop-1-enyl]-1,4-dioxaspiro[4.5]decane-3-carboxylic acid.
| Compound Name | (2R,3R)-8-methyl-2-[(E)-prop-1-enyl]-1,4-dioxaspiro[4.5]decane-3-carboxylic acid |
|---|---|
| PubChem CID | 155005884 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | (2R,3R)-8-methyl-2-[(E)-prop-1-enyl]-1,4-dioxaspiro[4.5]decane-3-carboxylic acid |
| SMILES | C/C=C/[C@H]1OC2(CCC(C)CC2)O[C@H]1C(=O)O |
| InChI | InChI=1S/C13H20O4/c1-3-4-10-11(12(14)15)17-13(16-10)7-5-9(2)6-8-13/h3-4,9-11H,5-8H2,1-2H3,(H,14,15)/b4-3+/t9?,10-,11-,13?/m1/s1 |
| InChIKey | FNQYHBYEJQXJCD-APNWMPADSA-N |
| XLogP | 2.34 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|