C12H22O — CID 155006906
2-methoxy-5-propan-2-yl-1,2,3,3a,4,5,6,6a-octahydropentalene (PubChem CID 155006906) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is 2-methoxy-5-propan-2-yl-1,2,3,3a,4,5,6,6a-octahydropentalene.
| Compound Name | 2-methoxy-5-propan-2-yl-1,2,3,3a,4,5,6,6a-octahydropentalene |
|---|---|
| PubChem CID | 155006906 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | 2-methoxy-5-propan-2-yl-1,2,3,3a,4,5,6,6a-octahydropentalene |
| SMILES | COC1CC2CC(C(C)C)CC2C1 |
| InChI | InChI=1S/C12H22O/c1-8(2)9-4-10-6-12(13-3)7-11(10)5-9/h8-12H,4-7H2,1-3H3 |
| InChIKey | XNQSEROEUGEWBO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |