About 1-[(1Z)-buta-1,3-dienyl]-3-chloro-2,5-dimethylbenzene
1-[(1Z)-buta-1,3-dienyl]-3-chloro-2,5-dimethylbenzene (PubChem CID 155007916) has the molecular formula C12H13Cl
and a molecular weight of 192.69 g/mol. Its IUPAC name is 1-[(1Z)-buta-1,3-dienyl]-3-chloro-2,5-dimethylbenzene.
Molecular Properties
| Compound Name | 1-[(1Z)-buta-1,3-dienyl]-3-chloro-2,5-dimethylbenzene |
| PubChem CID | 155007916 |
| Molecular Formula | C12H13Cl |
| Molecular Weight | 192.69 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 1-[(1Z)-buta-1,3-dienyl]-3-chloro-2,5-dimethylbenzene |
| SMILES | C=C/C=C\c1cc(C)cc(Cl)c1C |
| InChI | InChI=1S/C12H13Cl/c1-4-5-6-11-7-9(2)8-12(13)10(11)3/h4-8H,1H2,2-3H3/b6-5- |
| InChIKey | DATXEHCPOAMILH-WAYWQWQTSA-N |
| XLogP | 4.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.69 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1Z)-buta-1,3-dienyl]-3-chloro-2,5-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1Z)-buta-1,3-dienyl]-3-chloro-2,5-dimethylbenzene?
The IUPAC name of 1-[(1Z)-buta-1,3-dienyl]-3-chloro-2,5-dimethylbenzene (CID 155007916) is 1-[(1Z)-buta-1,3-dienyl]-3-chloro-2,5-dimethylbenzene.
What is the SMILES notation for 1-[(1Z)-buta-1,3-dienyl]-3-chloro-2,5-dimethylbenzene?
The canonical SMILES for 1-[(1Z)-buta-1,3-dienyl]-3-chloro-2,5-dimethylbenzene is C=C/C=C\c1cc(C)cc(Cl)c1C.
What is the InChIKey of 1-[(1Z)-buta-1,3-dienyl]-3-chloro-2,5-dimethylbenzene?
The InChIKey is DATXEHCPOAMILH-WAYWQWQTSA-N. The full InChI is InChI=1S/C12H13Cl/c1-4-5-6-11-7-9(2)8-12(13)10(11)3/h4-8H,1H2,2-3H3/b6-5-.
What are the key properties of 1-[(1Z)-buta-1,3-dienyl]-3-chloro-2,5-dimethylbenzene?
1-[(1Z)-buta-1,3-dienyl]-3-chloro-2,5-dimethylbenzene has a molecular weight of 192.69 g/mol, XLogP of 4.16, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1Z)-buta-1,3-dienyl]-3-chloro-2,5-dimethylbenzene is sourced from PubChem (CID 155007916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).