C12H13Cl — CID 155007916
1-[(1Z)-buta-1,3-dienyl]-3-chloro-2,5-dimethylbenzene (PubChem CID 155007916) has the molecular formula C12H13Cl and a molecular weight of 192.69 g/mol. Its IUPAC name is 1-[(1Z)-buta-1,3-dienyl]-3-chloro-2,5-dimethylbenzene.
| Compound Name | 1-[(1Z)-buta-1,3-dienyl]-3-chloro-2,5-dimethylbenzene |
|---|---|
| PubChem CID | 155007916 |
| Molecular Formula | C12H13Cl |
| Molecular Weight | 192.69 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 1-[(1Z)-buta-1,3-dienyl]-3-chloro-2,5-dimethylbenzene |
| SMILES | C=C/C=C\c1cc(C)cc(Cl)c1C |
| InChI | InChI=1S/C12H13Cl/c1-4-5-6-11-7-9(2)8-12(13)10(11)3/h4-8H,1H2,2-3H3/b6-5- |
| InChIKey | DATXEHCPOAMILH-WAYWQWQTSA-N |
| XLogP | 4.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.69 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|