C33H46ClFN2O4S — CID 155008517
5-[(E)-9-aminosulfanyl-3-ethyl-4-methoxy-5-methyldec-5-enyl]-3-(4-chloro-3-fluoro-2-propylphenyl)-3,4-dihydro-2H-1,5-benzoxazepine-7-carboxylic acid (PubChem CID 155008517) has the molecular formula C33H46ClFN2O4S and a molecular weight of 621.26 g/mol. Its IUPAC name is 5-[(E)-9-aminosulfanyl-3-ethyl-4-methoxy-5-methyldec-5-enyl]-3-(4-chloro-3-fluoro-2-propylphenyl)-3,4-dihydro-2H-1,5-benzoxazepine-7-carboxylic acid.
| Compound Name | 5-[(E)-9-aminosulfanyl-3-ethyl-4-methoxy-5-methyldec-5-enyl]-3-(4-chloro-3-fluoro-2-propylphenyl)-3,4-dihydro-2H-1,5-benzoxazepine-7-carboxylic acid |
|---|---|
| PubChem CID | 155008517 |
| Molecular Formula | C33H46ClFN2O4S |
| Molecular Weight | 621.26 g/mol |
| Exact Mass | 620.29 |
| IUPAC Name | 5-[(E)-9-aminosulfanyl-3-ethyl-4-methoxy-5-methyldec-5-enyl]-3-(4-chloro-3-fluoro-2-propylphenyl)-3,4-dihydro-2H-1,5-benzoxazepine-7-carboxylic acid |
| SMILES | CCCc1c(C2COc3ccc(C(=O)O)cc3N(CCC(CC)C(OC)/C(C)=C/CCC(C)SN)C2)ccc(Cl)c1F |
| InChI | InChI=1S/C33H46ClFN2O4S/c1-6-9-27-26(13-14-28(34)31(27)35)25-19-37(29-18-24(33(38)39)12-15-30(29)41-20-25)17-16-23(7-2)32(40-5)21(3)10-8-11-22(4)42-36/h10,12-15,18,22-23,25,32H,6-9,11,16-17,19-20,36H2,1-5H3,(H,38,39)/b21-10+ |
| InChIKey | SLTURIWJJLDQKL-UFFVCSGVSA-N |
| XLogP | 8.27 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.26 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|