C30H34N10O2S — CID 155008974
4-[2-[4-(4-morpholin-4-ylpiperidin-1-yl)anilino]pyrimidin-5-yl]-2-[1-(tetrazol-1-ylmethylsulfanyl)ethoxy]benzonitrile (PubChem CID 155008974) has the molecular formula C30H34N10O2S and a molecular weight of 598.74 g/mol. Its IUPAC name is 4-[2-[4-(4-morpholin-4-ylpiperidin-1-yl)anilino]pyrimidin-5-yl]-2-[1-(tetrazol-1-ylmethylsulfanyl)ethoxy]benzonitrile.
| Compound Name | 4-[2-[4-(4-morpholin-4-ylpiperidin-1-yl)anilino]pyrimidin-5-yl]-2-[1-(tetrazol-1-ylmethylsulfanyl)ethoxy]benzonitrile |
|---|---|
| PubChem CID | 155008974 |
| Molecular Formula | C30H34N10O2S |
| Molecular Weight | 598.74 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | 4-[2-[4-(4-morpholin-4-ylpiperidin-1-yl)anilino]pyrimidin-5-yl]-2-[1-(tetrazol-1-ylmethylsulfanyl)ethoxy]benzonitrile |
| SMILES | CC(Oc1cc(-c2cnc(Nc3ccc(N4CCC(N5CCOCC5)CC4)cc3)nc2)ccc1C#N)SCn1cnnn1 |
| InChI | InChI=1S/C30H34N10O2S/c1-22(43-21-40-20-34-36-37-40)42-29-16-23(2-3-24(29)17-31)25-18-32-30(33-19-25)35-26-4-6-27(7-5-26)38-10-8-28(9-11-38)39-12-14-41-15-13-39/h2-7,16,18-20,22,28H,8-15,21H2,1H3,(H,32,33,35) |
| InChIKey | MFPZVNLGESYGCG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 130.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.74 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|