C24H26FN5 — CID 155010111
5-[1-[3-(3-fluorophenyl)anilino]ethenyl]-N-(1-piperidin-4-ylethenyl)-1H-pyrazol-4-amine (PubChem CID 155010111) has the molecular formula C24H26FN5 and a molecular weight of 403.51 g/mol. Its IUPAC name is 5-[1-[3-(3-fluorophenyl)anilino]ethenyl]-N-(1-piperidin-4-ylethenyl)-1H-pyrazol-4-amine.
| Compound Name | 5-[1-[3-(3-fluorophenyl)anilino]ethenyl]-N-(1-piperidin-4-ylethenyl)-1H-pyrazol-4-amine |
|---|---|
| PubChem CID | 155010111 |
| Molecular Formula | C24H26FN5 |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | 5-[1-[3-(3-fluorophenyl)anilino]ethenyl]-N-(1-piperidin-4-ylethenyl)-1H-pyrazol-4-amine |
| SMILES | C=C(Nc1cccc(-c2cccc(F)c2)c1)c1[nH]ncc1NC(=C)C1CCNCC1 |
| InChI | InChI=1S/C24H26FN5/c1-16(18-9-11-26-12-10-18)29-23-15-27-30-24(23)17(2)28-22-8-4-6-20(14-22)19-5-3-7-21(25)13-19/h3-8,13-15,18,26,28-29H,1-2,9-12H2,(H,27,30) |
| InChIKey | BIIFJPOHOURASC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 64.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |