About (Z)-3,3-dimethyl-1-[(2S)-pyrrolidin-2-yl]but-1-en-1-ol
(Z)-3,3-dimethyl-1-[(2S)-pyrrolidin-2-yl]but-1-en-1-ol (PubChem CID 155010751) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is (Z)-3,3-dimethyl-1-[(2S)-pyrrolidin-2-yl]but-1-en-1-ol.
Molecular Properties
| Compound Name | (Z)-3,3-dimethyl-1-[(2S)-pyrrolidin-2-yl]but-1-en-1-ol |
| PubChem CID | 155010751 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (Z)-3,3-dimethyl-1-[(2S)-pyrrolidin-2-yl]but-1-en-1-ol |
| SMILES | CC(C)(C)/C=C(\O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C10H19NO/c1-10(2,3)7-9(12)8-5-4-6-11-8/h7-8,11-12H,4-6H2,1-3H3/b9-7-/t8-/m0/s1 |
| InChIKey | KLENEXHRLMQIDJ-FZGDARCMSA-N |
| XLogP | 2.23 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3,3-dimethyl-1-[(2S)-pyrrolidin-2-yl]but-1-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3,3-dimethyl-1-[(2S)-pyrrolidin-2-yl]but-1-en-1-ol?
The IUPAC name of (Z)-3,3-dimethyl-1-[(2S)-pyrrolidin-2-yl]but-1-en-1-ol (CID 155010751) is (Z)-3,3-dimethyl-1-[(2S)-pyrrolidin-2-yl]but-1-en-1-ol.
What is the SMILES notation for (Z)-3,3-dimethyl-1-[(2S)-pyrrolidin-2-yl]but-1-en-1-ol?
The canonical SMILES for (Z)-3,3-dimethyl-1-[(2S)-pyrrolidin-2-yl]but-1-en-1-ol is CC(C)(C)/C=C(\O)[C@@H]1CCCN1.
What is the InChIKey of (Z)-3,3-dimethyl-1-[(2S)-pyrrolidin-2-yl]but-1-en-1-ol?
The InChIKey is KLENEXHRLMQIDJ-FZGDARCMSA-N. The full InChI is InChI=1S/C10H19NO/c1-10(2,3)7-9(12)8-5-4-6-11-8/h7-8,11-12H,4-6H2,1-3H3/b9-7-/t8-/m0/s1.
What are the key properties of (Z)-3,3-dimethyl-1-[(2S)-pyrrolidin-2-yl]but-1-en-1-ol?
(Z)-3,3-dimethyl-1-[(2S)-pyrrolidin-2-yl]but-1-en-1-ol has a molecular weight of 169.27 g/mol, XLogP of 2.23, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3,3-dimethyl-1-[(2S)-pyrrolidin-2-yl]but-1-en-1-ol is sourced from PubChem (CID 155010751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).