C27H28N2O2 — CID 155011720
N-[1-oxo-3-phenyl-1-(2-phenylpiperidin-1-yl)propan-2-yl]benzamide (PubChem CID 155011720) has the molecular formula C27H28N2O2 and a molecular weight of 412.53 g/mol. Its IUPAC name is N-[1-oxo-3-phenyl-1-(2-phenylpiperidin-1-yl)propan-2-yl]benzamide.
| Compound Name | N-[1-oxo-3-phenyl-1-(2-phenylpiperidin-1-yl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 155011720 |
| Molecular Formula | C27H28N2O2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | N-[1-oxo-3-phenyl-1-(2-phenylpiperidin-1-yl)propan-2-yl]benzamide |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)N1CCCCC1c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H28N2O2/c30-26(23-16-8-3-9-17-23)28-24(20-21-12-4-1-5-13-21)27(31)29-19-11-10-18-25(29)22-14-6-2-7-15-22/h1-9,12-17,24-25H,10-11,18-20H2,(H,28,30) |
| InChIKey | HNESWORRBWVWDP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |