C10H14O3 — CID 155011867
2-hydroxy-2,3,4a,5,6,7,8,8a-octahydronaphthalene-1,4-dione (PubChem CID 155011867) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is 2-hydroxy-2,3,4a,5,6,7,8,8a-octahydronaphthalene-1,4-dione.
| Compound Name | 2-hydroxy-2,3,4a,5,6,7,8,8a-octahydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 155011867 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2-hydroxy-2,3,4a,5,6,7,8,8a-octahydronaphthalene-1,4-dione |
| SMILES | O=C1CC(O)C(=O)C2CCCCC12 |
| InChI | InChI=1S/C10H14O3/c11-8-5-9(12)10(13)7-4-2-1-3-6(7)8/h6-7,9,12H,1-5H2 |
| InChIKey | ATCFODKDGLOIGZ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |